Difference between revisions of "Ec-07 007340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Gene == Gene Ec-07_007340 == * left end position: ** 7068873 * transcription direction: ** NEGATIVE * right end position: ** 7070187 * centisome position: ** 91.5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] ==
+
== Gene Ec-07_007340 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 7068873
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
+
** 7070187
−
* molecular weight:
+
* centisome position:
−
** 1049.959    
+
** 91.536896    
 
* Synonym(s):
 
* Synonym(s):
−
** icosatetraenoyl-CoA
+
** Esi_0305_0007
−
** eicosatetraenoyl-CoA
+
** Esi0305_0007
 +
** P5CR
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16042]]
+
* Reaction: [[PYRROLINECARBREDUCT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN66-546]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PROSYN-PWY]]
 +
* [[ARG-PRO-PWY]]
 +
* [[PWY-6344]]
 +
* [[PWY-4981]]
 +
* [[PWY-3341]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7068873}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581164 71581164]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=7070187}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74265 74265]
+
{{#set: centisome position=91.536896   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0305_0007|Esi0305_0007|P5CR}}
−
{{#set: inchi key=InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J}}
+
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}}
−
{{#set: common name=(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA}}
+
{{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}}
−
{{#set: molecular weight=1049.959   }}
+
−
{{#set: common name=icosatetraenoyl-CoA|eicosatetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16042}}
+

Latest revision as of 19:35, 21 March 2018

Gene Ec-07_007340

  • left end position:
    • 7068873
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7070187
  • centisome position:
    • 91.536896
  • Synonym(s):
    • Esi_0305_0007
    • Esi0305_0007
    • P5CR

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_007340&oldid=27934"