|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-LACTATE-DEHYDROGENASE-RXN L-LACTATE-DEHYDROGENASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1) |
| + | * inchi key: |
| + | ** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L |
| * common name: | | * common name: |
− | ** L-lactate dehydrogenase | + | ** N-acetyl-α-D-glucosamine 1-phosphate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.1.1.27 EC-1.1.1.27] | + | ** 299.174 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[NAG1P-URIDYLTRANS-RXN]] |
− | ** 1 [[NAD]][c] '''+''' 1 [[L-LACTATE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PYRUVATE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 NAD+[c] '''+''' 1 (S)-lactate[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 pyruvate[c]
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] |
− | | + | * [[RXN-16426]] |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-12_006780]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways == | + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''13''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-6901]], superpathway of glucose and xylose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''12''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-5481]], pyruvate fermentation to lactate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5481 PWY-5481] | + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway | + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23444 23444]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256] |
− | * LIGAND-RXN: | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00703 R00703] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776] |
− | * UNIPROT: | + | * BIGG : 43457 |
− | ** [http://www.uniprot.org/uniprot/P04034 P04034] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P04642 P04642]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937] |
− | ** [http://www.uniprot.org/uniprot/P06150 P06150]
| + | * HMDB : HMDB01367 |
− | ** [http://www.uniprot.org/uniprot/P20373 P20373] | + | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}} |
− | ** [http://www.uniprot.org/uniprot/P13491 P13491] | + | {{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}} |
− | ** [http://www.uniprot.org/uniprot/P22988 P22988] | + | {{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}} |
− | ** [http://www.uniprot.org/uniprot/P56512 P56512]
| + | {{#set: molecular weight=299.174 }} |
− | ** [http://www.uniprot.org/uniprot/Q7M1E1 Q7M1E1]
| + | {{#set: consumed by=NAG1P-URIDYLTRANS-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P33571 P33571] | + | {{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN|RXN-16426}} |
− | ** [http://www.uniprot.org/uniprot/P13743 P13743]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26283 P26283]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01462 Q01462]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06176 Q06176]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PNC8 Q9PNC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59244 Q59244]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13490 P13490]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22989 P22989]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56511 P56511]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60176 Q60176]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33232 P33232]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00344 P00344]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00345 P00345]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00337 P00337]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00340 P00340]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00341 P00341]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07864 P07864]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07195 P07195]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00338 P00338]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00343 P00343]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00342 P00342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06151 P06151]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00336 P00336]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00339 P00339]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13714 P13714]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50933 P50933]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23569 O23569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47698 P47698]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CII4 Q9CII4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CGG8 Q9CGG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07251 Q07251]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62545 Q62545]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42121 P42121]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42119 P42119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42120 P42120]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42123 P42123]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19629 P19629]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60009 Q60009]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27888 Q27888]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19869 P19869]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19858 P19858]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13715 P13715]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10655 P10655]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14561 P14561]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20619 P20619]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16125 P16125]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29038 P29038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0C0J3 P0C0J3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16115 P16115]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48662 Q48662]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRJ5 Q9ZRJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81272 O81272]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SBE4 Q9SBE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96569 Q96569]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96570 Q96570]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46454 P46454]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=L-lactate dehydrogenase}}
| + | |
− | {{#set: ec number=EC-1.1.1.27}}
| + | |
− | {{#set: gene associated=Ec-12_006780}} | + | |
− | {{#set: in pathway=P122-PWY|PWY-6901|P124-PWY|PWY-5481}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |