Difference between revisions of "PWY-6908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
| − | ** | + | ** thiamine diphosphate biosynthesis IV (eukaryotes) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** thiamin diphosphate biosynthesis IV (eukaryotes) | ||
| + | ** vitamin B1 biosynthesis IV (eukaryotes) | ||
| + | ** thiamine diphosphate biosynthesis (plants) | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[THI-P-SYN-RXN]] |
| − | + | ** 1 associated gene(s): | |
| − | * [[RXN- | + | *** [[Ec-06_006870]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[orthology-aragem]] | ||
| + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-06_002580]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4191 RXNQT-4191] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-33630}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=thiamine diphosphate biosynthesis IV (eukaryotes)}} | |
| − | + | {{#set: common name=thiamin diphosphate biosynthesis IV (eukaryotes)|vitamin B1 biosynthesis IV (eukaryotes)|thiamine diphosphate biosynthesis (plants)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:35, 21 March 2018
Pathway PWY-6908
- taxonomic range:
- common name:
- thiamine diphosphate biosynthesis IV (eukaryotes)
- Synonym(s):
- thiamin diphosphate biosynthesis IV (eukaryotes)
- vitamin B1 biosynthesis IV (eukaryotes)
- thiamine diphosphate biosynthesis (plants)
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- THI-P-SYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- THIAMIN-PYROPHOSPHOKINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
