Difference between revisions of "PWY-5101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-183924]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-224756]
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-203691 TAX-203691]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183939 TAX-183939]
 
* common name:
 
* common name:
** dioleoyl phosphatidate
+
** L-isoleucine biosynthesis II
* molecular weight:
+
** 698.959   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:1-18:1-PA
 
** 1-18:1-2-18:1-phosphatidic acid
 
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 
** 1-18:1-2-18:1-phosphatidate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-15068]]
+
'''4''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETOOHBUTSYN-RXN]]
* [[RXN-15043]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Ec-20_001390]]
 +
*** [[Ec-12_005520]]
 +
*** [[Ec-12_005560]]
 +
*** [[Ec-01_007170]]
 +
*** [[Ec-12_005530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-03_000220]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-7745]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_002120]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R-2-METHYLMALATE-DEHYDRATASE-RXN R-2-METHYLMALATE-DEHYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16062 RXN-16062]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7743 RXN-7743]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7744 RXN-7744]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-183924}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245731 25245731]
+
{{#set: taxonomic range=TAX-224756}}
* CHEBI:
+
{{#set: taxonomic range=TAX-183925}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
+
{{#set: taxonomic range=TAX-203691}}
* HMDB : HMDB07865
+
{{#set: taxonomic range=TAX-183939}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
+
{{#set: common name=L-isoleucine biosynthesis II}}
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
+
{{#set: reaction found=4}}
{{#set: common name=dioleoyl phosphatidate}}
+
{{#set: total reaction=8}}
{{#set: molecular weight=698.959    }}
+
{{#set: completion rate=50.0}}
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
+
{{#set: consumed by=RXN-15068}}
+
{{#set: produced by=RXN-15043}}
+

Latest revision as of 20:00, 21 March 2018

Pathway PWY-5101

Reaction(s) found

4 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links