Difference between revisions of "RXN-13724"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13724 RXN-13724] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13724 RXN-13724] ==
−
* smiles:
+
* direction:
−
** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K
+
** [http://enzyme.expasy.org/EC/1.3.1.96 EC-1.3.1.96]
−
* common name:
+
−
** N-acetylglutamyl-phosphate
+
−
* molecular weight:
+
−
** 266.124   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-Acetyl-L-glutamyl 5-phosphate
 
−
** N-acetyl-L-glutamate-5-phosphate
 
−
** N-acetyl-glutamyl-P
 
−
** N-acetylglutamyl-P
 
−
** N-acetyl-5-glutamyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-465]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[SQUALENE]][c]
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
* With common name(s):
−
* [[ACETYLGLUTKIN-RXN]]
+
** 1 presqualene diphosphate[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 diphosphate[c] '''+''' 1 squalene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_001030]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6105]], botryococcenes and methylated squalene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6105 PWY-6105]
 +
** '''2''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 43209
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22233 22233]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791951 49791951]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB06456
+
{{#set: ec number=EC-1.3.1.96}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-11_001030}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04133 C04133]
+
{{#set: in pathway=PWY-6105}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57936 57936]
+
{{#set: reconstruction source=orthology-aragem}}
−
* METABOLIGHTS : MTBLC57936
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K}}
+
−
{{#set: common name=N-acetylglutamyl-phosphate}}
+
−
{{#set: molecular weight=266.124    }}
+
−
{{#set: common name=N-Acetyl-L-glutamyl 5-phosphate|N-acetyl-L-glutamate-5-phosphate|N-acetyl-glutamyl-P|N-acetylglutamyl-P|N-acetyl-5-glutamyl phosphate}}
+
−
{{#set: reversible reaction associated=N-ACETYLGLUTPREDUCT-RXN|ACETYLGLUTKIN-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Reaction RXN-13724

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 presqualene diphosphate[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 diphosphate[c] + 1 squalene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6105, botryococcenes and methylated squalene biosynthesis: PWY-6105
    • 2 reactions found over 9 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13724&oldid=28040"