Difference between revisions of "Ec-05 004910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
(Created page with "Category:Gene == Gene Ec-05_004910 == * left end position: ** 6918130 * transcription direction: ** NEGATIVE * right end position: ** 6925066 * centisome position: ** 75.9...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] ==
+
== Gene Ec-05_004910 ==
−
* smiles:
+
* left end position:
−
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
+
** 6918130
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
+
** 6925066
−
* molecular weight:
+
* centisome position:
−
** 488.442    
+
** 75.99415    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0229_0014
 +
** Esi0229_0014
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-6883]]
−
* [[RXN-12270]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=6918130}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=6925066}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63259 63259]
+
{{#set: centisome position=75.99415    }}
−
* PUBCHEM:
+
{{#set: common name=Esi_0229_0014|Esi0229_0014}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940204 52940204]
+
{{#set: reaction associated=RXN-6883}}
−
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}}
+
{{#set: pathway associated=PWY-4302}}
−
{{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N}}
+
−
{{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
+
−
{{#set: molecular weight=488.442    }}
+
−
{{#set: produced by=RXN-12270}}
+

Latest revision as of 19:35, 21 March 2018

Gene Ec-05_004910

  • left end position:
    • 6918130
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6925066
  • centisome position:
    • 75.99415
  • Synonym(s):
    • Esi_0229_0014
    • Esi0229_0014

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_004910&oldid=28043"