Difference between revisions of "CPD-15318"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R08190 R08190] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With identifie...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) |
| + | * inchi key: | ||
| + | ** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L | ||
| + | * common name: | ||
| + | ** α-D-ribose 5-phosphate | ||
| + | * molecular weight: | ||
| + | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** α-D-ribofuranose 5-phosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14997]] |
| − | + | * [[RXN-15345]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RIBOKIN-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC18189 |
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | ||
| + | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}} | ||
| + | {{#set: common name=α-D-ribose 5-phosphate}} | ||
| + | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: common name=α-D-ribofuranose 5-phosphate}} | ||
| + | {{#set: consumed by=RXN-14997|RXN-15345}} | ||
| + | {{#set: produced by=RIBOKIN-RXN}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-15318
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
- common name:
- α-D-ribose 5-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- α-D-ribofuranose 5-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.
