Difference between revisions of "CPD-8620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate re...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
 
* common name:
 
* common name:
−
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
+
** 5α-cholesta-8-en-3-one
−
** EsV-1-128
+
* molecular weight:
−
** EsV-1-180
+
** 384.644   
−
** Ribonucleoside-diphosphate reductase small chain
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ADP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[DADP]][c]
+
* [[RXN66-23]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ADP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 H2O[c] '''+''' 1 dADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-19_000440]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-06_005120]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-11_002170]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-21_002920]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-06_005570]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203379 25203379]
−
{{#set: common name=EsV-1-128}}
+
* HMDB : HMDB12178
−
{{#set: common name=EsV-1-180}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
−
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
+
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
−
{{#set: ec number=EC-1.17.4.1}}
+
{{#set: common name=5α-cholesta-8-en-3-one}}
−
{{#set: gene associated=Ec-19_000440|Ec-06_005120|Ec-11_002170|Ec-21_002920|Ec-06_005570}}
+
{{#set: molecular weight=384.644    }}
−
{{#set: in pathway=PWY-7220}}
+
{{#set: produced by=RXN66-23}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:36, 21 March 2018

Metabolite CPD-8620

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
  • common name:
    • 5α-cholesta-8-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8620&oldid=28076"