Difference between revisions of "Ec-12 004580"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-12_004580 == * left end position: ** 4264212 * transcription direction: ** POSITIVE * right end position: ** 4270019 * centisome position: ** 51.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_004580 == |
− | * | + | * left end position: |
− | ** | + | ** 4264212 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4270019 |
− | * | + | * centisome position: |
− | ** | + | ** 51.15386 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0070_0069 |
− | ** | + | ** Esi0070_0069 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4264212}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4270019}} | |
− | + | {{#set: centisome position=51.15386 }} | |
− | + | {{#set: common name=Esi_0070_0069|Esi0070_0069}} | |
− | + | {{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:09, 21 March 2018
Gene Ec-12_004580
- left end position:
- 4264212
- transcription direction:
- POSITIVE
- right end position:
- 4270019
- centisome position:
- 51.15386
- Synonym(s):
- Esi_0070_0069
- Esi0070_0069
Reactions associated
- Reaction: HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome