Difference between revisions of "HISTAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFATE SULFATE] == * smiles: ** O=S(=O)([O-])[O-] * inchi key: ** InChIKey=QAOWNCQODCNURD-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == * smiles: ** C1(=C(NC=N1)CC[N+]) * inchi key: ** InChIKey=NTYJJOPFIAHUR...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=C(NC=N1)CC[N+]) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O |
* common name: | * common name: | ||
| − | ** | + | ** histamine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 112.154 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** peremin |
| − | ** | + | ** 1H-Imidazole-4-ethanamine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HISTIDINE-DECARBOXYLASE-RXN]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 51-45-6 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201573 25201573] |
| − | * HMDB : | + | * HMDB : HMDB00870 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00388 C00388] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58432 58432] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC58432 |
| − | {{#set: smiles= | + | {{#set: smiles=C1(=C(NC=N1)CC[N+])}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O}} |
| − | {{#set: common name= | + | {{#set: common name=histamine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=112.154 }} |
| − | {{#set: common name= | + | {{#set: common name=peremin|1H-Imidazole-4-ethanamine}} |
| − | + | {{#set: produced by=HISTIDINE-DECARBOXYLASE-RXN}} | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite HISTAMINE
- smiles:
- C1(=C(NC=N1)CC[N+])
- inchi key:
- InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O
- common name:
- histamine
- molecular weight:
- 112.154
- Synonym(s):
- peremin
- 1H-Imidazole-4-ethanamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-45-6
- PUBCHEM:
- HMDB : HMDB00870
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58432
"C1(=C(NC=N1)CC[N+])" cannot be used as a page name in this wiki.
