Difference between revisions of "Ec-07 003670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == * smiles: ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-07_003670 == * Synonym(s): ** Esi_0046_0100 ** Esi0046_0100 ** PKS == Reactions associated == * Reaction: NARINGENIN-CHALCONE-SYNTHASE-RXN **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_003670 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0046_0100 |
− | ** | + | ** Esi0046_0100 |
− | ** | + | ** PKS |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] |
− | + | ** Source: [[orthology-aragem]] | |
− | == | + | * Reaction: [[RXN-7645]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5059]] | ||
+ | * [[PWY1F-FLAVSYN]] | ||
+ | * [[PWY-6787]] | ||
+ | * [[PWY-7397]] | ||
+ | * [[PWY-6316]] | ||
+ | * [[PWY-5135]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0046_0100|Esi0046_0100|PKS}} | |
− | + | {{#set: reaction associated=NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN-7645}} | |
− | + | {{#set: pathway associated=PWY-5059|PWY1F-FLAVSYN|PWY-6787|PWY-7397|PWY-6316|PWY-5135}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-07_003670
- Synonym(s):
- Esi_0046_0100
- Esi0046_0100
- PKS
Reactions associated
- Reaction: NARINGENIN-CHALCONE-SYNTHASE-RXN
- Source: orthology-aragem
- Reaction: RXN-7645
- Source: orthology-aragem