Difference between revisions of "S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * smiles: **...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N))) |
− | ** | + | * inchi key: |
+ | ** InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** S-adenosyl-4-methylthio-2-oxobutanoate |
+ | * molecular weight: | ||
+ | ** 397.405 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[DAPASYN-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459852 5459852] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573603.html 4573603] |
− | {{#set: reaction | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16490 16490] | ||
+ | * BIGG : 43797 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04425 C04425] | ||
+ | {{#set: smiles=C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))}} | ||
+ | {{#set: inchi key=InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N}} | ||
+ | {{#set: common name=S-adenosyl-4-methylthio-2-oxobutanoate}} | ||
+ | {{#set: molecular weight=397.405 }} | ||
+ | {{#set: reversible reaction associated=DAPASYN-RXN}} |
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE
- smiles:
- C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))
- inchi key:
- InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N
- common name:
- S-adenosyl-4-methylthio-2-oxobutanoate
- molecular weight:
- 397.405
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))" cannot be used as a page name in this wiki.