Difference between revisions of "Menaquinones"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinones Menaquinones] == * common name: ** a menaquinone * Synonym(s): ** a vitamin K2 ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinones Menaquinones] ==
* smiles:
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
+
 
* common name:
 
* common name:
** (5α)-campestan-3-one
+
** a menaquinone
* molecular weight:
+
** 400.687   
+
 
* Synonym(s):
 
* Synonym(s):
** methylcholestanone
+
** a vitamin K2
** (24R)-24-methyl-5α-cholestan-3-one
+
** 3-dehydro-campestanol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5254]]
 +
* [[RXN-15740]]
 +
* [[RXN0-6554]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-711]]
+
* [[RXN-14107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a menaquinone}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201374 25201374]
+
{{#set: common name=a vitamin K2}}
* LIGAND-CPD:
+
{{#set: consumed by=RXN0-5254|RXN-15740|RXN0-6554}}
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
+
{{#set: produced by=RXN-14107}}
* HMDB : HMDB12116
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
+
{{#set: common name=(5α)-campestan-3-one}}
+
{{#set: molecular weight=400.687    }}
+
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
+
{{#set: produced by=RXN-711}}
+

Latest revision as of 19:36, 21 March 2018

Metabolite Menaquinones

  • common name:
    • a menaquinone
  • Synonym(s):
    • a vitamin K2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links