|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GSHTRAN-RXN GSHTRAN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C=C1(C(CC([N+])C([O-])=O)C1) |
| + | * inchi key: |
| + | ** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N |
| * common name: | | * common name: |
− | ** Thioredoxin-like fold | + | ** hypoglycin A |
− | ** Glutathione S-transferase, N-terminal | + | * molecular weight: |
− | ** Glutathione S-transferase, C-terminal-like
| + | ** 141.169 |
− | ** Membrane associated eicosanoid/glutathione metabolism-like domain
| + | |
− | ** Membrane-associated, eicosanoid/glutathione metabolism (MAPEG) protein
| + | |
− | ** DSBA-like thioredoxin domain
| + | |
− | ** Glutathione S-transferase (GST)
| + | |
− | ** putative Glutathione S-transferase
| + | |
− | ** Glutathione S-transferase
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.5.1.18 EC-2.5.1.18] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** hypoglycine |
| + | ** hypoglycine A |
| + | ** hypoglycin |
| + | ** L-β-(methylenecyclopropyl)-alanine |
| + | ** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-9157]] |
− | ** 1 [[GLUTATHIONE]][c] '''+''' 1 [[RX]][c] '''=>''' 1 [[S-Substituted-Glutathione]][c] '''+''' 1 [[HX]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 glutathione[c] '''+''' 1 RX[c] '''=>''' 1 a glutathione-toxin conjugate[c] '''+''' 1 HX[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-20_001950]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-16_001680]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-00_008360]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-13_002370]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008890]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008370]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-10_001330]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-18_001510]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-06_002520]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-13_002360]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-06_008030]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008870]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008380]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-09_003670]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_000320]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-27_000390]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-11_002590]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-27_000400]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-13_000340]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-24_001030]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | * [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03522 R03522] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430] |
− | * UNIPROT:
| + | * Wikipedia : Hypoglycin |
− | ** [http://www.uniprot.org/uniprot/P30116 P30116]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P04903 P04903]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287] |
− | ** [http://www.uniprot.org/uniprot/P04904 P04904] | + | * HMDB : HMDB29427 |
− | ** [http://www.uniprot.org/uniprot/P13745 P13745] | + | {{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}} |
− | ** [http://www.uniprot.org/uniprot/P08011 P08011] | + | {{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q7M0B7 Q7M0B7] | + | {{#set: common name=hypoglycin A}} |
− | ** [http://www.uniprot.org/uniprot/P08009 P08009]
| + | {{#set: molecular weight=141.169 }} |
− | ** [http://www.uniprot.org/uniprot/P04905 P04905]
| + | {{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}} |
− | ** [http://www.uniprot.org/uniprot/P21266 P21266]
| + | {{#set: consumed by=RXN-9157}} |
− | ** [http://www.uniprot.org/uniprot/P09211 P09211]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28161 P28161]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08863 Q08863]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30109 P30109]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28338 P28338]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46088 P46088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15964 P15964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46439 P46439]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG97 Q9VG97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03013 Q03013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41043 P41043]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28801 P28801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46418 P46418]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46425 P46425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9D2 P0A9D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08263 P08263]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30712 P30712]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9NAW7 Q9NAW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08515 P08515]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10620 P10620]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19639 P19639]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WU21 Q9WU21]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15626 P15626]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08862 Q08862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26624 P26624]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03377 Q03377]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19157 P19157]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20137 P20137]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG95 Q9VG95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG98 Q9VG98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG96 Q9VG96]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31817 O31817]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X6U4 Q8X6U4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30713 P30713]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42706 Q42706]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q28514 Q28514]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TXB7 Q9TXB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09792 P09792]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16413 P16413]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81706 P81706]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09488 P09488]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M446 Q7M446]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10299 P10299]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B6 Q7M0B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0C0 Q7M0C0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F7 Q7M0F7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22416 P22416]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30102 P30102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28342 P28342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24473 P24473]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F4 Q7M0F4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F3 Q7M0F3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26697 P26697]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PS57 Q9PS57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JLQ6 Q9JLQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30115 P30115]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09210 P09210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01579 Q01579]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24472 P24472]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F5 Q7M0F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F6 Q7M0F6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F2 Q7M0F2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TQQ8 Q9TQQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B8 Q7M0B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M059 Q7M059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30568 P30568]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03425 Q03425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10649 P10649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46422 P46422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45875 P45875]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42769 P42769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46436 P46436]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F1 Q7M0F1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42760 P42760]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42761 P42761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9GQE3 Q9GQE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46427 P46427]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48438 P48438]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08392 Q08392]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08393 Q08393]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30711 P30711]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH6 Q9UDH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH3 Q9UDH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH2 Q9UDH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH1 Q9UDH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46432 P46432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46433 P46433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46420 P46420]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27013 P27013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27014 P27014]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20135 P20135]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46409 P46409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46421 P46421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46431 P46431]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B9 Q7M0B9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E7 Q7M3E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E8 Q7M3E8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E9 Q7M3E9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64471 Q64471]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91VB0 Q91VB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15214 P15214]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47954 P47954]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60550 Q60550]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12760 Q12760]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65032 O65032]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65857 O65857]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82451 O82451]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24595 O24595]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49235 O49235]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04437 O04437]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30110 P30110]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30111 P30111]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04874 O04874]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32111 P32111]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22330 O22330]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49821 O49821]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65344 O65344]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81602 O81602]
| + | |
− | ** [http://www.uniprot.org/uniprot/O85984 O85984]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q21355 Q21355]
| + | |
− | ** [http://www.uniprot.org/uniprot/O16115 O16115]
| + | |
− | ** [http://www.uniprot.org/uniprot/O16116 O16116]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRT5 Q9ZRT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRW8 Q9ZRW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SM20 Q9SM20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZP62 Q9ZP62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS18 Q9ZS18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS16 Q9ZS16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SB97 Q9SB97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS17 Q9ZS17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRR6 Q9ZRR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20432 P20432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14942 P14942]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08010 P08010]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04906 P04906]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12653 P12653]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04907 P04907]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Thioredoxin-like fold}}
| + | |
− | {{#set: common name=Glutathione S-transferase, N-terminal}}
| + | |
− | {{#set: common name=Glutathione S-transferase, C-terminal-like}}
| + | |
− | {{#set: common name=Membrane associated eicosanoid/glutathione metabolism-like domain}}
| + | |
− | {{#set: common name=Membrane-associated, eicosanoid/glutathione metabolism (MAPEG) protein}}
| + | |
− | {{#set: common name=DSBA-like thioredoxin domain}} | + | |
− | {{#set: common name=Glutathione S-transferase (GST)}}
| + | |
− | {{#set: common name=putative Glutathione S-transferase}}
| + | |
− | {{#set: common name=Glutathione S-transferase}} | + | |
− | {{#set: ec number=EC-2.5.1.18}} | + | |
− | {{#set: gene associated=Ec-20_001950|Ec-16_001680|Ec-00_008360|Ec-13_002370|Ec-00_008890|Ec-00_008370|Ec-10_001330|Ec-18_001510|Ec-06_002520|Ec-13_002360|Ec-06_008030|Ec-00_008870|Ec-00_008380|Ec-09_003670|Ec-00_000320|Ec-27_000390|Ec-11_002590|Ec-27_000400|Ec-13_000340|Ec-24_001030}} | + | |
− | {{#set: in pathway=PWY-6842|PWY-4061}} | + | |
− | {{#set: reconstruction category=orthology|annotation}}
| + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |