Difference between revisions of "Ec-26 005670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-26_005670 == * left end position: ** 5802717 * transcription direction: ** NEGATIVE * right end position: ** 5826667 * centisome position: ** 88.1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_005670 == |
− | * | + | * left end position: |
− | ** | + | ** 5802717 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5826667 |
− | * | + | * centisome position: |
− | ** | + | ** 88.14234 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0059_0106 | ||
+ | ** Esi0059_0106 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[INORGPYROPHOSPHAT-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5802717}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5826667}} | |
− | + | {{#set: centisome position=88.14234 }} | |
− | + | {{#set: common name=Esi_0059_0106|Esi0059_0106}} | |
− | + | {{#set: reaction associated=INORGPYROPHOSPHAT-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-26_005670
- left end position:
- 5802717
- transcription direction:
- NEGATIVE
- right end position:
- 5826667
- centisome position:
- 88.14234
- Synonym(s):
- Esi_0059_0106
- Esi0059_0106
Reactions associated
- Reaction: INORGPYROPHOSPHAT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome