Difference between revisions of "Ec-19 004160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
(Created page with "Category:Gene == Gene Ec-19_004160 == * Synonym(s): ** Esi_0278_0030 ** Esi0278_0030 ** Nrt2;3 == Reactions associated == * Reaction: TCV3 ** Source: orthology-arag...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
+
== Gene Ec-19_004160 ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
+
* inchi key:
+
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
+
* common name:
+
** episterol
+
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0278_0030
 +
** Esi0278_0030
 +
** Nrt2;3
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN3O-218]]
+
* Reaction: [[TCV3]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0278_0030|Esi0278_0030|Nrt2;3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
+
{{#set: reaction associated=TCV3}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
+
* HMDB : HMDB06847
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
+
{{#set: common name=episterol}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: consumed by=RXN3O-218}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-19_004160

  • Synonym(s):
    • Esi_0278_0030
    • Esi0278_0030
    • Nrt2;3

Reactions associated

Pathways associated

External links