Difference between revisions of "Ec-12 005240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
(Created page with "Category:Gene == Gene Ec-12_005240 == * Synonym(s): ** Esi_0444_0006 ** Esi0444_0006 == Reactions associated == * Reaction: DIHYDROKAEMPFEROL-4-REDUCTASE-RXN ** Sourc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
+
== Gene Ec-12_005240 ==
* smiles:
+
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
+
* inchi key:
+
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
+
* common name:
+
** ferroheme b
+
* molecular weight:
+
** 614.482   
+
 
* Synonym(s):
 
* Synonym(s):
** protoheme IX
+
** Esi_0444_0006
** ferroprotoporphyrin IX
+
** Esi0444_0006
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* Reaction: [[RXN-1101]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-1106]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-1124]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-600]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-7784]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9725]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6027]]
 +
* [[PWY-361]]
 +
* [[PWY-5152]]
 +
* [[PWY1F-823]]
 +
* [[PWY-6035]]
 
== External links  ==
 
== External links  ==
* CHEBI:
+
{{#set: common name=Esi_0444_0006|Esi0444_0006}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
+
{{#set: reaction associated=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN|RXN-1101|RXN-1106|RXN-1124|RXN-600|RXN-7784|RXN-9725}}
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
+
{{#set: pathway associated=PWY-6027|PWY-361|PWY-5152|PWY1F-823|PWY-6035}}
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
+
{{#set: common name=ferroheme b}}
+
{{#set: molecular weight=614.482    }}
+
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
+
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-12_005240

  • Synonym(s):
    • Esi_0444_0006
    • Esi0444_0006

Reactions associated

Pathways associated

External links