Difference between revisions of "EPISTEROL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15122 RXN-15122] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase beta su...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15122 RXN-15122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
 
* common name:
 
* common name:
−
** Tryptophan synthase beta subunit-like PLP-dependent enzyme
+
** episterol
−
** L-threonine ammonia-lyase
+
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN3O-218]]
−
** 1 [[THR]][c] '''=>''' 1 [[CPD-15056]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-threonine[c] '''=>''' 1 (2Z)-2-aminobut-2-enoate[c] '''+''' 1 H+[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_007490]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-03_001910]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[ILEUSYN-PWY]], L-isoleucine biosynthesis I (from threonine): [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826]
+
−
** '''4''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-5437]], L-threonine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5437 PWY-5437]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
−
{{#set: common name=L-threonine ammonia-lyase}}
+
* CHEBI:
−
{{#set: gene associated=Ec-06_007490|Ec-03_001910}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
−
{{#set: in pathway=ILEUSYN-PWY|PWY-5826|PWY-5437}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* HMDB : HMDB06847
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
 +
{{#set: common name=episterol}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: consumed by=RXN3O-218}}

Latest revision as of 19:37, 21 March 2018

Metabolite EPISTEROL

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
  • inchi key:
    • InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
  • common name:
    • episterol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=EPISTEROL&oldid=28229"