Difference between revisions of "RXN-14177"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-15152]][c] '''=>''' 1 [[CPD-15153]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] '''=>''' 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_000650]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-16_000550]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-17_000350]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-27_005280]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-06_002620]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-08_006620]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-09_002660]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26465 26465] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-2.1.1.163}} |
− | {{#set: | + | {{#set: gene associated=Ec-27_000650|Ec-16_000550|Ec-17_000350|Ec-27_005280|Ec-06_002620|Ec-08_006620|Ec-09_002660}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:37, 21 March 2018
Contents
Reaction RXN-14177
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 CPD-15152[c] => 1 CPD-15153[c] + 1 PROTON[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] => 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_000650
- Source: orthology-aragem
- Gene: Ec-16_000550
- Source: orthology-aragem
- Gene: Ec-17_000350
- Source: orthology-aragem
- Gene: Ec-27_005280
- Source: orthology-aragem
- Gene: Ec-06_002620
- Source: orthology-aragem
- Gene: Ec-08_006620
- Source: orthology-aragem
- Gene: Ec-09_002660
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- RHEA: