Difference between revisions of "CPD-10269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_002670 == * left end position: ** 2858184 * transcription direction: ** POSITIVE * right end position: ** 2858473 * centisome position: ** 15.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-00_002670 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
* left end position:
+
* smiles:
** 2858184
+
** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
* right end position:
+
* common name:
** 2858473
+
** palmitoleoyl-CoA
* centisome position:
+
* molecular weight:
** 15.085607    
+
** 999.899    
 
* Synonym(s):
 
* Synonym(s):
** Esi_1595_0001
+
** 16:1-delta9-CoA
** Esi1595_0001
+
** 9z-hexadecenoyl-CoA
 +
** cis-9-hexadecenoyl-CoA
 +
** palmitoleoyl coenzyme A
 +
** (9Z)-hexadec-9-enoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-1961]]
+
* [[RXN-17019]]
** esiliculosus_genome
+
* [[RXN-17008]]
***automated-name-match
+
* [[RXN-17009]]
== Pathways associated ==
+
* [[RXN-10662]]
 +
* [[RXN-17788]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-7248]]
 +
* [[RXN-10664]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=2858184}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393]
{{#set: right end position=2858473}}
+
* CHEBI:
{{#set: centisome position=15.085607   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540]
{{#set: common name=Esi_1595_0001|Esi1595_0001}}
+
* METABOLIGHTS : MTBLC61540
{{#set: reaction associated=RXN-1961}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}}
 +
{{#set: common name=palmitoleoyl-CoA}}
 +
{{#set: molecular weight=999.899   }}
 +
{{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}}
 +
{{#set: consumed by=RXN-17019|RXN-17008|RXN-17009|RXN-10662|RXN-17788}}
 +
{{#set: produced by=RXN0-7248|RXN-10664}}

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-10269

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
  • common name:
    • palmitoleoyl-CoA
  • molecular weight:
    • 999.899
  • Synonym(s):
    • 16:1-delta9-CoA
    • 9z-hexadecenoyl-CoA
    • cis-9-hexadecenoyl-CoA
    • palmitoleoyl coenzyme A
    • (9Z)-hexadec-9-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.