Difference between revisions of "D-SEDOHEPTULOSE-7-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-7-P D-SEDOHEPTULOSE-7-P] == * smiles: ** C(O)C(C(O)C(C(O)C(COP(=O)([O-])[O-])O)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-7-P D-SEDOHEPTULOSE-7-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(C(O)C(C(O)C(COP(=O)([O-])[O-])O)O)=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JDTUMPKOJBQPKX-GBNDHIKLSA-L |
* common name: | * common name: | ||
| − | ** | + | ** D-sedoheptulose 7-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 288.147 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-Sedoheptulose-7-P |
| − | ** | + | ** heptulose 7-phosphate |
| − | ** | + | ** sedoheptulose-7-P |
| + | ** sedo-heptulose-7-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9140]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[1TRANSKETO-RXN]] |
| + | * [[TRANSALDOL-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 2646-35-7 | ||
| + | * BIGG : 34485 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878379 46878379] |
| + | * HMDB : HMDB01068 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05382 C05382] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57483 57483] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57483 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(O)C(C(O)C(C(O)C(COP(=O)([O-])[O-])O)O)=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=JDTUMPKOJBQPKX-GBNDHIKLSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=D-sedoheptulose 7-phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=288.147 }} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=D-Sedoheptulose-7-P|heptulose 7-phosphate|sedoheptulose-7-P|sedo-heptulose-7-phosphate}} |
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: consumed by=RXN-9140}} |
| + | {{#set: produced by=SEDOHEPTULOSE-BISPHOSPHATASE-RXN}} | ||
| + | {{#set: reversible reaction associated=1TRANSKETO-RXN|TRANSALDOL-RXN}} | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite D-SEDOHEPTULOSE-7-P
- smiles:
- C(O)C(C(O)C(C(O)C(COP(=O)([O-])[O-])O)O)=O
- inchi key:
- InChIKey=JDTUMPKOJBQPKX-GBNDHIKLSA-L
- common name:
- D-sedoheptulose 7-phosphate
- molecular weight:
- 288.147
- Synonym(s):
- D-Sedoheptulose-7-P
- heptulose 7-phosphate
- sedoheptulose-7-P
- sedo-heptulose-7-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2646-35-7
- BIGG : 34485
- PUBCHEM:
- HMDB : HMDB01068
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57483
"C(O)C(C(O)C(C(O)C(COP(=O)([O-])[O-])O)O)=O" cannot be used as a page name in this wiki.
