Difference between revisions of "RXN-10715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10715 RXN-10715] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10715 RXN-10715] ==
−
* smiles:
+
* direction:
−
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
−
* common name:
+
−
** nicotine-1'-N-oxide
+
−
* molecular weight:
+
−
** 178.233   
+
 
* Synonym(s):
 
* Synonym(s):
−
** nicotine N'-oxide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-81]]
+
** 1 [[INDOLE_ACETALDEHYDE]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 indole acetaldehyde[c] '''+''' 1 NAD+[c] '''+''' 1 H2O[c] '''=>''' 2 H+[c] '''+''' 1 NADH[c] '''+''' 1 indole-3-acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_002450]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6307]], L-tryptophan degradation X (mammalian, via tryptamine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02678 R02678]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
+
{{#set: ec number=EC-1.2.1.3}}
−
* HMDB : HMDB01497
+
{{#set: gene associated=Ec-11_002450}}
−
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
+
{{#set: in pathway=PWY-6307}}
−
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=nicotine-1'-N-oxide}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: molecular weight=178.233    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=nicotine N'-oxide}}
+
−
{{#set: produced by=RXN66-81}}
+

Latest revision as of 19:38, 21 March 2018

Reaction RXN-10715

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6307, L-tryptophan degradation X (mammalian, via tryptamine): PWY-6307
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10715&oldid=28313"