Difference between revisions of "CPD-13172"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_005770 == * left end position: ** 5636448 * transcription direction: ** POSITIVE * right end position: ** 5642249 * centisome position: ** 72.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 155.13 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylic acid |
| − | ** | + | ** HCC |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12252]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166] |
| − | {{#set: | + | {{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}} |
| − | + | {{#set: molecular weight=155.13 }} | |
| − | {{#set: | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}} |
| + | {{#set: produced by=RXN-12252}} | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite CPD-13172
- smiles:
- C(=O)(C1(O)(C=CCCC(=O)1))[O-]
- inchi key:
- InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
- common name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- molecular weight:
- 155.13
- Synonym(s):
- 6-hydroxy-2-cyclohexen-one-carboxylic acid
- HCC
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.
