Difference between revisions of "Ec-15 002910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
(Created page with "Category:Gene == Gene Ec-15_002910 == * left end position: ** 3117084 * transcription direction: ** NEGATIVE * right end position: ** 3123761 * centisome position: ** 57.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Gene Ec-15_002910 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 3117084
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** dGTP
+
** 3123761
−
* molecular weight:
+
* centisome position:
−
** 503.152    
+
** 57.74246    
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyguanosine-5'-triphosphate
+
** Esi_0076_0063
−
** deoxy-GTP
+
** Esi0076_0063
−
** deoxyguanosine-triphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14217]]
+
* Reaction: [[AMACETOXID-RXN]]
−
* [[RXN-14208]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN0-385]]
+
*** Assignment: go-term
−
* [[RXN-11410]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AMINEOXID-RXN]]
−
* [[RXN0-746]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[DGDPKIN-RXN]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[AMINEPHEN-RXN]]
−
* [[RXN-14207]]
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-11784]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-5821]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-6381]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9597]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN6666-4]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7431]]
 +
* [[PWY-3981]]
 +
* [[THRDLCTCAT-PWY]]
 +
* [[PWY6666-2]]
 +
* [[2PHENDEG-PWY]]
 +
* [[PWY-6802]]
 +
* [[PWY-5751]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2564-35-4
+
{{#set: left end position=3117084}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
+
{{#set: right end position=3123761}}
−
* HMDB : HMDB01440
+
{{#set: centisome position=57.74246   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0076_0063|Esi0076_0063}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
+
{{#set: reaction associated=AMACETOXID-RXN|AMINEOXID-RXN|AMINEPHEN-RXN|RXN-11784|RXN-5821|RXN-6381|RXN-9597|RXN6666-4}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7431|PWY-3981|THRDLCTCAT-PWY|PWY6666-2|2PHENDEG-PWY|PWY-6802|PWY-5751}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
+
−
* BIGG : 34502
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
+
−
{{#set: common name=dGTP}}
+
−
{{#set: molecular weight=503.152   }}
+
−
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
+
−
{{#set: consumed by=RXN-14217|RXN-14208|RXN0-385|RXN-11410}}
+
−
{{#set: produced by=RXN0-746|DGDPKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14207}}
+

Latest revision as of 19:38, 21 March 2018

Gene Ec-15_002910

  • left end position:
    • 3117084
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3123761
  • centisome position:
    • 57.74246
  • Synonym(s):
    • Esi_0076_0063
    • Esi0076_0063

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_002910&oldid=28347"