Difference between revisions of "DGTP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-26_005180 == * left end position: ** 5335895 * transcription direction: ** NEGATIVE * right end position: ** 5346303 * centisome position: ** 81.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J |
| − | * | + | * common name: |
| − | ** | + | ** dGTP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 503.152 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxyguanosine-5'-triphosphate |
| − | ** | + | ** deoxy-GTP |
| + | ** deoxyguanosine-triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14217]] |
| − | ** | + | * [[RXN-14208]] |
| − | ** | + | * [[RXN0-385]] |
| − | == | + | * [[RXN-11410]] |
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-746]] | ||
| + | * [[DGDPKIN-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14207]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2564-35-4 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112] |
| − | {{#set: | + | * HMDB : HMDB01440 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] | ||
| + | * BIGG : 34502 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} | ||
| + | {{#set: common name=dGTP}} | ||
| + | {{#set: molecular weight=503.152 }} | ||
| + | {{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} | ||
| + | {{#set: consumed by=RXN-14217|RXN-14208|RXN0-385|RXN-11410}} | ||
| + | {{#set: produced by=RXN0-746|DGDPKIN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14207}} | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite DGTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
- common name:
- dGTP
- molecular weight:
- 503.152
- Synonym(s):
- 2'-deoxyguanosine-5'-triphosphate
- deoxy-GTP
- deoxyguanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
