|
|
| (2 intermediate revisions by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IPPISOM-RXN IPPISOM-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == |
| − | * direction: | + | * smiles: |
| − | ** REVERSIBLE | + | ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) |
| | + | * inchi key: |
| | + | ** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M |
| | * common name: | | * common name: |
| − | ** isopentenyl-diphosphate delta-isomerase type 1 | + | ** 2-carboxy-L-xylonolactone |
| − | ** isopentenyl-diphosphate delta-isomerase
| + | * molecular weight: |
| − | * ec number: | + | ** 191.117 |
| − | ** [http://enzyme.expasy.org/EC/5.3.3.2 EC-5.3.3.2] | + | |
| | * Synonym(s): | | * Synonym(s): |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | * [[RXN-12871]] |
| − | ** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''<=>''' 1 [[CPD-4211]][c]
| + | == Reaction(s) known to produce the compound == |
| − | * With common name(s):
| + | * [[RXN-12870]] |
| − | ** 1 isopentenyl diphosphate[c] '''<=>''' 1 dimethylallyl diphosphate[c]
| + | == Reaction(s) of unknown directionality == |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * [[Ec-11_001030]] | + | |
| − | ** ESILICULOSUS_GENOME
| + | |
| − | ***GO-TERM
| + | |
| − | * [[Ec-18_002690]]
| + | |
| − | ** ESILICULOSUS_GENOME
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** [[pantograph]]-[[aragem]]
| + | |
| − | == Pathways == | + | |
| − | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
| + | |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
| + | |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
| + | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | * [[PWY-6383]], mono-trans, poly-cis decaprenyl phosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6383 PWY-6383] | + | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
| + | |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| + | |
| − | * [[PWY-5123]], trans, trans-farnesyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5123 PWY-5123]
| + | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
| − | * [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
| + | |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | * [[PWY-6859]], all-trans-farnesol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859]
| + | |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
| − | * [[PWY-7102]], bisabolene biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102]
| + | |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
| − | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
| + | |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
| − | == Reconstruction information ==
| + | |
| − | * [[orthology]]:
| + | |
| − | ** [[pantograph]]:
| + | |
| − | *** [[aragem]]
| + | |
| − | * [[annotation]]:
| + | |
| − | ** [[pathwaytools]]:
| + | |
| − | *** [[esiliculosus_genome]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA: | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23284 23284] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445] |
| − | * LIGAND-RXN:
| + | {{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01123 R01123]
| + | {{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}} |
| − | * UNIPROT:
| + | {{#set: common name=2-carboxy-L-xylonolactone}} |
| − | ** [http://www.uniprot.org/uniprot/P15496 P15496]
| + | {{#set: molecular weight=191.117 }} |
| − | ** [http://www.uniprot.org/uniprot/Q10132 Q10132]
| + | {{#set: consumed by=RXN-12871}} |
| − | ** [http://www.uniprot.org/uniprot/Q38929 Q38929]
| + | {{#set: produced by=RXN-12870}} |
| − | ** [http://www.uniprot.org/uniprot/Q42553 Q42553]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P93355 P93355]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O81691 O81691]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9SAY0 Q9SAY0]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O81660 O81660]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O81659 O81659]
| + | |
| − | {{#set: direction=REVERSIBLE}} | + | |
| − | {{#set: common name=isopentenyl-diphosphate delta-isomerase type 1}} | + | |
| − | {{#set: common name=isopentenyl-diphosphate delta-isomerase}} | + | |
| − | {{#set: ec number=EC-5.3.3.2}} | + | |
| − | {{#set: gene associated=Ec-11_001030|Ec-18_002690}} | + | |
| − | {{#set: in pathway=PWY-6174|PWY-922|NONMEVIPP-PWY|PWY-6383|PWY-7391|PWY-5123|PWY-7560|PWY-6859|PWY-7102|PWY-7524}} | + | |
| − | {{#set: reconstruction category=orthology}}
| + | |
| − | {{#set: reconstruction tool=pantograph}}
| + | |
| − | {{#set: reconstruction source=aragem}}
| + | |
| − | {{#set: reconstruction category=annotation}}
| + | |
| − | {{#set: reconstruction tool=pathwaytools}}
| + | |
| − | {{#set: reconstruction source=esiliculosus_genome}}
| + | |
