Difference between revisions of "RXN-16043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(O)C(O)C(O)1)CO))C2(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16043 RXN-16043] == * direction: ** LEFT-TO-RIGHT * common name: ** Lyso-phosphatidylcholine ac...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16043 RXN-16043] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L
+
 
* common name:
 
* common name:
** GDP-α-D-mannose
+
** Lyso-phosphatidylcholine acyltransferase
* molecular weight:
+
* ec number:
** 603.329   
+
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
 
* Synonym(s):
 
* Synonym(s):
** guanosine pyrophosphate mannose
 
** guanosine diphosphomannose
 
** guanosine diphosphate mannose
 
** GDP-mannose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-5464]]
+
* With identifiers:
* [[GDPMANDEHYDRA-RXN]]
+
** 1 [[Gamma-linolenoyl-groups]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[GAMMA-LINOLENOYL-COA]][c] '''+''' 1 [[Glycerolipids]][c]
* [[RXN-5462]]
+
* With common name(s):
* [[2.4.1.83-RXN]]
+
** 1 a [glycerolipid]-γ-linolenate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 γ-linolenoyl-CoA[c] '''+''' 1 a glycerolipid[c]
* [[RXN-5463]]
+
 
* [[2.4.1.142-RXN]]
+
== Genes associated with this reaction  ==
* [[RXN-16602]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
* Gene: [[Ec-16_002160]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[2.7.7.13-RXN]]
+
*** Assignment: AUTOMATED-NAME-MATCH
== Reaction(s) of unknown directionality ==
+
== Pathways  ==
* [[RXN-1882]]
+
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 18441-12-8
+
{{#set: direction=LEFT-TO-RIGHT}}
* CAS : 3123-67-9
+
{{#set: common name=Lyso-phosphatidylcholine acyltransferase}}
* BIGG : 1460457
+
{{#set: ec number=EC-2.3.1.23}}
* PUBCHEM:
+
{{#set: gene associated=Ec-16_002160}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878389 46878389]
+
{{#set: in pathway=PWY-5353}}
* HMDB : HMDB01163
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.genome.jp/dbget-bin/www_bget?C00096 C00096]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57527 57527]
+
* METABOLIGHTS : MTBLC57527
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))}}
+
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L}}
+
{{#set: common name=GDP-α-D-mannose}}
+
{{#set: molecular weight=603.329    }}
+
{{#set: common name=guanosine pyrophosphate mannose|guanosine diphosphomannose|guanosine diphosphate mannose|GDP-mannose}}
+
{{#set: consumed by=RXN-5464|GDPMANDEHYDRA-RXN|RXN-5462|2.4.1.83-RXN|RXN-5463|2.4.1.142-RXN|RXN-16602|GDP-MANNOSE-6-DEHYDROGENASE-RXN}}
+
{{#set: produced by=2.7.7.13-RXN}}
+
{{#set: reversible reaction associated=RXN-1882}}
+

Latest revision as of 19:38, 21 March 2018

Reaction RXN-16043

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Lyso-phosphatidylcholine acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5353, arachidonate biosynthesis I (6-desaturase, lower eukaryotes): PWY-5353
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links