Difference between revisions of "CPD-14900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-25_002400 == * left end position: ** 2682714 * transcription direction: ** POSITIVE * right end position: ** 2696376 * centisome position: ** 60.2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-25_002400 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] ==
* left end position:
+
* smiles:
** 2682714
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N
* right end position:
+
* common name:
** 2696376
+
** porifersta-5,7-dienol
* centisome position:
+
* molecular weight:
** 60.273003    
+
** 412.698    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0108_0047
+
** 24S-ethylcholesta-5,7-dien-3β-ol
** Esi0108_0047
+
** 7-dehydroclionasterol
 +
** moonisterol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[QUINOLINATE-SYNTHA-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-13892]]
***go-term
+
== Reaction(s) of unknown directionality ==
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
+
** esiliculosus_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-5316]]
+
* [[PWY-7342]]
+
* [[PYRIDNUCSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2682714}}
+
* CAS : 24057-73-6
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=2696376}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16058079 16058079]
{{#set: centisome position=60.273003   }}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: common name=Esi_0108_0047|Esi0108_0047}}
+
{{#set: inchi key=InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N}}
{{#set: reaction associated=QUINOLINATE-SYNTHA-RXN|QUINOLINATE-SYNTHE-MULTI-RXN}}
+
{{#set: common name=porifersta-5,7-dienol}}
{{#set: pathway associated=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}}
+
{{#set: molecular weight=412.698   }}
 +
{{#set: common name=24S-ethylcholesta-5,7-dien-3β-ol|7-dehydroclionasterol|moonisterol}}
 +
{{#set: produced by=RXN-13892}}

Latest revision as of 19:39, 21 March 2018

Metabolite CPD-14900

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N
  • common name:
    • porifersta-5,7-dienol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 24S-ethylcholesta-5,7-dien-3β-ol
    • 7-dehydroclionasterol
    • moonisterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.