Difference between revisions of "Ec-01 007000"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-01_007000 == * left end position: ** 5986555 * transcription direction: ** NEGATIVE * right end position: ** 6008007 * centisome position: ** 58.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_007000 == |
− | * | + | * left end position: |
− | ** | + | ** 5986555 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6008007 |
− | * | + | * centisome position: |
− | ** | + | ** 58.015812 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0002_0232 | ||
+ | ** Esi0002_0232 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PYRNUTRANSHYDROGEN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[TRANS-RXN0-277]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
+ | * [[NADPHOS-DEPHOS-PWY-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5986555}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6008007}} | |
− | + | {{#set: centisome position=58.015812 }} | |
− | + | {{#set: common name=Esi_0002_0232|Esi0002_0232}} | |
− | + | {{#set: reaction associated=PYRNUTRANSHYDROGEN-RXN|TRANS-RXN0-277}} | |
− | + | {{#set: pathway associated=PWY-5083|NADPHOS-DEPHOS-PWY|NADPHOS-DEPHOS-PWY-1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Ec-01_007000
- left end position:
- 5986555
- transcription direction:
- NEGATIVE
- right end position:
- 6008007
- centisome position:
- 58.015812
- Synonym(s):
- Esi_0002_0232
- Esi0002_0232
Reactions associated
- Reaction: PYRNUTRANSHYDROGEN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: TRANS-RXN0-277
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome