Difference between revisions of "Ec-12 000320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-12_000320 == * left end position: ** 291645 * transcription direction: ** NEGATIVE * right end position: ** 298838 * centisome position: ** 3.4985...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_000320 == |
− | * | + | * left end position: |
− | ** | + | ** 291645 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 298838 |
− | * | + | * centisome position: |
− | ** | + | ** 3.4985986 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0069_0046 |
− | ** | + | ** Esi0069_0046 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=291645}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=298838}} | |
− | + | {{#set: centisome position=3.4985986 }} | |
− | + | {{#set: common name=Esi_0069_0046|Esi0069_0046}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Ec-12_000320
- left end position:
- 291645
- transcription direction:
- NEGATIVE
- right end position:
- 298838
- centisome position:
- 3.4985986
- Synonym(s):
- Esi_0069_0046
- Esi0069_0046
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome