Difference between revisions of "Ec-18 000990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Ec-18_000990 == * left end position: ** 918229 * transcription direction: ** NEGATIVE * right end position: ** 927429 * centisome position: ** 18.638...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_000990 == |
− | * | + | * left end position: |
− | ** | + | ** 918229 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 927429 |
− | * | + | * centisome position: |
− | ** | + | ** 18.638351 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0020_0133 |
− | ** | + | ** Esi0020_0133 |
− | ** | + | ** GPPS |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GPPSYN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-9003]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-9384]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN0-5180]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[PWY-7709]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-7235]] | ||
+ | * [[PWY-7182]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY-7410]] | ||
+ | * [[PWY3O-19]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=918229}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=927429}} | |
− | + | {{#set: centisome position=18.638351 }} | |
− | + | {{#set: common name=Esi_0020_0133|Esi0020_0133|GPPS}} | |
− | + | {{#set: reaction associated=GPPSYN-RXN|RXN-9003|RXN-9384|RXN0-5180}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-6859|PWY-7709|PWY-6383|PWY-7235|PWY-7182|PWY-7141|PWY-5123|PWY-5122|PWY-7102|PWY-7659|PWY-7410|PWY3O-19}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Ec-18_000990
- left end position:
- 918229
- transcription direction:
- NEGATIVE
- right end position:
- 927429
- centisome position:
- 18.638351
- Synonym(s):
- Esi_0020_0133
- Esi0020_0133
- GPPS
Reactions associated
- Reaction: GPPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9003
- Source: orthology-aragem
- Reaction: RXN-9384
- Source: orthology-aragem
- Reaction: RXN0-5180
- Source: orthology-aragem
Pathways associated
- PWY-7736
- PWY-6859
- PWY-7709
- PWY-6383
- PWY-7235
- PWY-7182
- PWY-7141
- PWY-5123
- PWY-5122
- PWY-7102
- PWY-7659
- PWY-7410
- PWY3O-19