Difference between revisions of "Ec-16 000770"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
(Created page with "Category:Gene == Gene Ec-16_000770 == * left end position: ** 855749 * transcription direction: ** NEGATIVE * right end position: ** 875021 * centisome position: ** 16.032...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_000770 == |
− | * | + | * left end position: |
− | ** | + | ** 855749 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 875021 |
− | * | + | * centisome position: |
− | ** | + | ** 16.032305 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0208_0042 |
+ | ** Esi0208_0042 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=855749}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=875021}} | |
− | + | {{#set: centisome position=16.032305 }} | |
− | + | {{#set: common name=Esi_0208_0042|Esi0208_0042}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Ec-16_000770
- left end position:
- 855749
- transcription direction:
- NEGATIVE
- right end position:
- 875021
- centisome position:
- 16.032305
- Synonym(s):
- Esi_0208_0042
- Esi0208_0042
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome