Difference between revisions of "CPD-15666"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOLO-ACP-SYNTH-RXN HOLO-ACP-SYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** holo-[acy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOLO-ACP-SYNTH-RXN HOLO-ACP-SYNTH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
 
* common name:
 
* common name:
** holo-[acyl-carrier-protein] synthase
+
** 6-cis, 2-trans-tridecadienoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
+
** 955.803   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z, 2E-tridecadienoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[apo-ACP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[3-5-ADP]][c]
+
* [[RXN-14771]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 an apo-[acyl-carrier protein][c] '''+''' 1 coenzyme A[c] '''=>''' 1 H+[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-01_000130]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
* [[Ec-06_004620]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY-6012]], acyl carrier protein metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012 PWY-6012]
+
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[PWY-6012-1]], acyl carrier protein activation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R01625 R01625]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
* UNIPROT:
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.uniprot.org/uniprot/Q9PMP8 Q9PMP8]
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
** [http://www.uniprot.org/uniprot/P24224 P24224]
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
** [http://www.uniprot.org/uniprot/O84102 O84102]
+
{{#set: molecular weight=955.803    }}
** [http://www.uniprot.org/uniprot/Q9RQW2 Q9RQW2]
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
** [http://www.uniprot.org/uniprot/O83800 O83800]
+
{{#set: produced by=RXN-14771}}
** [http://www.uniprot.org/uniprot/Q9ZCX5 Q9ZCX5]
+
** [http://www.uniprot.org/uniprot/Q9ZL36 Q9ZL36]
+
** [http://www.uniprot.org/uniprot/O25488 O25488]
+
** [http://www.uniprot.org/uniprot/P96618 P96618]
+
** [http://www.uniprot.org/uniprot/O66995 O66995]
+
** [http://www.uniprot.org/uniprot/P0A4W8 P0A4W8]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=holo-[acyl-carrier-protein] synthase}}
+
{{#set: ec number=EC-2.7.8.7}}
+
{{#set: gene associated=Ec-01_000130|Ec-06_004620}}
+
{{#set: in pathway=PWY-6012|PWY-6012-1}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:39, 21 March 2018

Metabolite CPD-15666

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
  • common name:
    • 6-cis, 2-trans-tridecadienoyl-CoA
  • molecular weight:
    • 955.803
  • Synonym(s):
    • 6Z, 2E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.