Difference between revisions of "RXN-1641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE] == * smiles: ** CC4(OC(OP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1641 RXN-1641] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1641 RXN-1641] ==
* smiles:
+
* direction:
** CC4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(=O)4)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=PNHLMHWWFOPQLK-BKUUWRAGSA-L
+
** [http://enzyme.expasy.org/EC/2.3.1.158 EC-2.3.1.158]
* common name:
+
** GDP-4-dehydro-6-deoxy-α-D-mannose
+
* molecular weight:
+
** 585.314   
+
 
* Synonym(s):
 
* Synonym(s):
** GDP-4-keto-6-deoxymannose
 
** GDP-4-keto-6-deoxy-α-D-mannose
 
** GDP-4-dehydro-6-deoxy-α-D-talose
 
** GDP-4-oxo-6-deoxy-α-D-mannose
 
** GDP-4-dehydro-α-D-rhamnose
 
** GDP-4-dehydro-6-deoxymannose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[1.1.1.271-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''=>''' 1 [[Triacylglycerols]][c] '''+''' 1 [[2-Lysophosphatidylcholines]][c]
* [[GDPMANDEHYDRA-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 a phosphatidylcholine[c] '''=>''' 1 a triacyl-sn-glycerol[c] '''+''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* BIGG : 37116
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.158}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243979 25243979]
+
{{#set: in pathway=TRIGLSYN-PWY|PWY-7416}}
* HMDB : HMDB01346
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.genome.jp/dbget-bin/www_bget?C01222 C01222]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57964 57964]
+
* METABOLIGHTS : MTBLC57964
+
{{#set: smiles=CC4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(=O)4)}}
+
{{#set: inchi key=InChIKey=PNHLMHWWFOPQLK-BKUUWRAGSA-L}}
+
{{#set: common name=GDP-4-dehydro-6-deoxy-α-D-mannose}}
+
{{#set: molecular weight=585.314    }}
+
{{#set: common name=GDP-4-keto-6-deoxymannose|GDP-4-keto-6-deoxy-α-D-mannose|GDP-4-dehydro-6-deoxy-α-D-talose|GDP-4-oxo-6-deoxy-α-D-mannose|GDP-4-dehydro-α-D-rhamnose|GDP-4-dehydro-6-deoxymannose}}
+
{{#set: consumed by=1.1.1.271-RXN}}
+
{{#set: produced by=GDPMANDEHYDRA-RXN}}
+

Latest revision as of 19:39, 21 March 2018

Reaction RXN-1641

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
    • 7 reactions found over 7 reactions in the full pathway
  • PWY-7416, phospholipid remodeling (phosphatidylcholine, yeast): PWY-7416
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links