Difference between revisions of "COBALADENOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=COBALADENOSYLTRANS-RXN COBALADENOSYLTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** c...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=COBALADENOSYLTRANS-RXN COBALADENOSYLTRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cob(I)yrinic acid a,c-diamide adenosyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.17 EC-2.5.1.17] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[COB-I-ALAMIN]][c] '''=>''' 1 [[P3I]][c] '''+''' 1 [[ADENOSYLCOBALAMIN]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 cob(I)alamin[c] '''=>''' 1 PPPi[c] '''+''' 1 adenosylcobalamin[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_010830]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-6268]], adenosylcobalamin salvage from cobalamin: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6268 PWY-6268] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28671 28671] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01492 R01492] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P0A9H5 P0A9H5] |
− | * | + | ** [http://www.uniprot.org/uniprot/O30785 O30785] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=cob(I)yrinic acid a,c-diamide adenosyltransferase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-2.5.1.17}} |
− | + | {{#set: gene associated=Ec-06_010830}} | |
− | {{#set: | + | {{#set: in pathway=PWY-6268}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Contents
Reaction COBALADENOSYLTRANS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- cob(I)yrinic acid a,c-diamide adenosyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 COB-I-ALAMIN[c] => 1 P3I[c] + 1 ADENOSYLCOBALAMIN[c]
- With common name(s):
- 1 ATP[c] + 1 cob(I)alamin[c] => 1 PPPi[c] + 1 adenosylcobalamin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_010830
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6268, adenosylcobalamin salvage from cobalamin: PWY-6268
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links