Difference between revisions of "Ec-06 005060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
(Created page with "Category:Gene == Gene Ec-06_005060 == * left end position: ** 4261426 * transcription direction: ** NEGATIVE * right end position: ** 4263465 * centisome position: ** 48.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
+
== Gene Ec-06_005060 ==
−
* smiles:
+
* left end position:
−
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
+
** 4261426
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** 4263465
−
* molecular weight:
+
* centisome position:
−
** 221.167    
+
** 48.658867    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
+
** Esi_0052_0168
−
** 4-methyl-5-(2-phosphoethyl)-thiazole
+
** Esi0052_0168
−
** THZ-P
+
−
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
+
−
** HET-P
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[THI-P-SYN-RXN]]
+
* Reaction: [[2.7.13.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[THIAZOLSYN3-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4261426}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4263465}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
+
{{#set: centisome position=48.658867   }}
−
* BIGG : 43602
+
{{#set: common name=Esi_0052_0168|Esi0052_0168}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.7.13.3-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
+
−
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
+
−
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
+
−
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
−
{{#set: molecular weight=221.167   }}
+
−
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
+
−
{{#set: consumed by=THI-P-SYN-RXN}}
+
−
{{#set: produced by=THIAZOLSYN3-RXN}}
+

Latest revision as of 19:40, 21 March 2018

Gene Ec-06_005060

  • left end position:
    • 4261426
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4263465
  • centisome position:
    • 48.658867
  • Synonym(s):
    • Esi_0052_0168
    • Esi0052_0168

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_005060&oldid=28548"