Difference between revisions of "Ec-06 005060"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...") |
(Created page with "Category:Gene == Gene Ec-06_005060 == * left end position: ** 4261426 * transcription direction: ** NEGATIVE * right end position: ** 4263465 * centisome position: ** 48.6...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_005060 == |
− | * | + | * left end position: |
− | ** | + | ** 4261426 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4263465 |
− | * | + | * centisome position: |
− | ** | + | ** 48.658867 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0052_0168 |
− | ** | + | ** Esi0052_0168 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.13.3-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=4261426}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4263465}} | |
− | + | {{#set: centisome position=48.658867 }} | |
− | + | {{#set: common name=Esi_0052_0168|Esi0052_0168}} | |
− | + | {{#set: reaction associated=2.7.13.3-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:40, 21 March 2018
Gene Ec-06_005060
- left end position:
- 4261426
- transcription direction:
- NEGATIVE
- right end position:
- 4263465
- centisome position:
- 48.658867
- Synonym(s):
- Esi_0052_0168
- Esi0052_0168
Reactions associated
- Reaction: 2.7.13.3-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome