Difference between revisions of "Ec-25 000920"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-25_000920 == * left end position: ** 1107174 * transcription direction: ** POSITIVE * right end position: ** 1110207 * centisome position: ** 24.8...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_000920 == |
− | * | + | * left end position: |
− | ** | + | ** 1107174 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1110207 |
− | * | + | * centisome position: |
− | ** | + | ** 24.875072 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0232_0033 |
− | ** | + | ** Esi0232_0033 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1107174}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1110207}} | |
− | + | {{#set: centisome position=24.875072 }} | |
− | + | {{#set: common name=Esi_0232_0033|Esi0232_0033}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Gene Ec-25_000920
- left end position:
- 1107174
- transcription direction:
- POSITIVE
- right end position:
- 1110207
- centisome position:
- 24.875072
- Synonym(s):
- Esi_0232_0033
- Esi0232_0033
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome