Difference between revisions of "THZ-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-16_000770 == * left end position: ** 855749 * transcription direction: ** NEGATIVE * right end position: ** 875021 * centisome position: ** 16.032...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-16_000770 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
* left end position:
+
* smiles:
** 855749
+
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
* right end position:
+
* common name:
** 875021
+
** 4-methyl-5-(2-phosphooxyethyl)thiazole
* centisome position:
+
* molecular weight:
** 16.032305    
+
** 221.167    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0208_0042
+
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
** Esi0208_0042
+
** 4-methyl-5-(2-phosphoethyl)-thiazole
 +
** THZ-P
 +
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 +
** HET-P
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[THI-P-SYN-RXN]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
* [[THIAZOLSYN3-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=855749}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
{{#set: right end position=875021}}
+
* CHEBI:
{{#set: centisome position=16.032305   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
{{#set: common name=Esi_0208_0042|Esi0208_0042}}
+
* BIGG : 43602
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
 +
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
 +
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
 +
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
 +
{{#set: molecular weight=221.167   }}
 +
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
 +
{{#set: consumed by=THI-P-SYN-RXN}}
 +
{{#set: produced by=THIAZOLSYN3-RXN}}

Latest revision as of 19:40, 21 March 2018

Metabolite THZ-P

  • smiles:
    • CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
  • inchi key:
    • InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
  • common name:
    • 4-methyl-5-(2-phosphooxyethyl)thiazole
  • molecular weight:
    • 221.167
  • Synonym(s):
    • 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
    • 4-methyl-5-(2-phosphoethyl)-thiazole
    • THZ-P
    • 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
    • HET-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.