Difference between revisions of "CPD-13040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_001560 == * left end position: ** 1320397 * transcription direction: ** NEGATIVE * right end position: ** 1351936 * centisome position: ** 20.4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * inchi key: ** InChIKey=AWHAUPZH...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-27_001560 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] ==
* left end position:
+
* smiles:
** 1320397
+
** CCCC(OCC(OC(CCC)=O)CO)=O
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
* right end position:
+
* common name:
** 1351936
+
** 1,2-dibutyrin
* centisome position:
+
* molecular weight:
** 20.471567    
+
** 232.276    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0366_0020
+
** glycerol 1,2-dibutanoate
** Esi0366_0020
+
** β-dibutyrin
 +
** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
 +
** dibutyrylglycerol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-12086]]
***go-term
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1320397}}
+
* CAS : 24814-35-5
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=1351936}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007]
{{#set: centisome position=20.471567   }}
+
* CHEMSPIDER:
{{#set: common name=Esi_0366_0020|Esi0366_0020}}
+
** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519]
{{#set: reaction associated=ATPASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537]
 +
{{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}}
 +
{{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}}
 +
{{#set: common name=1,2-dibutyrin}}
 +
{{#set: molecular weight=232.276   }}
 +
{{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}}
 +
{{#set: produced by=RXN-12086}}

Latest revision as of 19:40, 21 March 2018

Metabolite CPD-13040

  • smiles:
    • CCCC(OCC(OC(CCC)=O)CO)=O
  • inchi key:
    • InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
  • common name:
    • 1,2-dibutyrin
  • molecular weight:
    • 232.276
  • Synonym(s):
    • glycerol 1,2-dibutanoate
    • β-dibutyrin
    • butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
    • dibutyrylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links