Difference between revisions of "EDTA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_004200 == * left end position: ** 3495287 * transcription direction: ** POSITIVE * right end position: ** 3505099 * centisome position: ** 39.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_004200 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] ==
−
* left end position:
+
* smiles:
−
** 3495287
+
** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
−
* right end position:
+
* common name:
−
** 3505099
+
** EDTA
−
* centisome position:
+
* molecular weight:
−
** 39.91075    
+
** 290.229    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0062_0104
+
** ethylenediaminetetraacetic acid
−
** Esi0062_0104
+
** ethylenediaminetetraacetate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[F16BDEPHOS-RXN]]
+
* [[TransportSeed_EDTA]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[TransportSeed_EDTA]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[GLYCOLYSIS]]
+
* [[ExchangeSeed_EDTA]]
−
* [[SUCSYN-PWY]]
+
−
* [[CALVIN-PWY]]
+
−
* [[GLUCONEO-PWY]]
+
−
* [[PWY-5484]]
+
−
* [[P185-PWY]]
+
−
* [[PWY66-399]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3495287}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827]
−
{{#set: right end position=3505099}}
+
* CHEBI:
−
{{#set: centisome position=39.91075   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191]
−
{{#set: common name=Esi_0062_0104|Esi0062_0104}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=F16BDEPHOS-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284]
−
{{#set: pathway associated=GLYCOLYSIS|SUCSYN-PWY|CALVIN-PWY|GLUCONEO-PWY|PWY-5484|P185-PWY|PWY66-399}}
+
* HMDB : HMDB15109
 +
{{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}}
 +
{{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}}
 +
{{#set: common name=EDTA}}
 +
{{#set: molecular weight=290.229   }}
 +
{{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}}
 +
{{#set: consumed by=TransportSeed_EDTA}}
 +
{{#set: produced by=TransportSeed_EDTA}}
 +
{{#set: reversible reaction associated=ExchangeSeed_EDTA}}

Latest revision as of 19:40, 21 March 2018

Metabolite EDTA

  • smiles:
    • C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
  • inchi key:
    • InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
  • common name:
    • EDTA
  • molecular weight:
    • 290.229
  • Synonym(s):
    • ethylenediaminetetraacetic acid
    • ethylenediaminetetraacetate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=EDTA&oldid=28600"