Difference between revisions of "Ec-19 004000"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONIC_ACID ARACHIDONIC_ACID] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)[O-] * common na...") |
(Created page with "Category:Gene == Gene Ec-19_004000 == * left end position: ** 4338466 * transcription direction: ** POSITIVE * right end position: ** 4353256 * centisome position: ** 72.6...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_004000 == |
− | * | + | * left end position: |
− | ** | + | ** 4338466 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4353256 |
− | * | + | * centisome position: |
− | ** | + | ** 72.66275 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0088_0079 |
− | ** | + | ** Esi0088_0079 |
− | ** | + | ** NADPH oxidase |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-10745]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4338466}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4353256}} | |
− | + | {{#set: centisome position=72.66275 }} | |
− | + | {{#set: common name=Esi_0088_0079|Esi0088_0079|NADPH oxidase}} | |
− | + | {{#set: reaction associated=RXN-10745}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Gene Ec-19_004000
- left end position:
- 4338466
- transcription direction:
- POSITIVE
- right end position:
- 4353256
- centisome position:
- 72.66275
- Synonym(s):
- Esi_0088_0079
- Esi0088_0079
- NADPH oxidase
Reactions associated
- Reaction: RXN-10745
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome