Difference between revisions of "Ec-12 001530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-12_001530 == * left end position: ** 1508114 * transcription direction: ** NEGATIVE * right end position: ** 1530127 * centisome position: ** 18.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_001530 == |
− | * | + | * left end position: |
− | ** | + | ** 1508114 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1530127 |
− | * | + | * centisome position: |
− | ** | + | ** 18.091465 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0087_0017 | ||
+ | ** Esi0087_0017 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=1508114}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1530127}} | |
− | + | {{#set: centisome position=18.091465 }} | |
− | + | {{#set: common name=Esi_0087_0017|Esi0087_0017}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Gene Ec-12_001530
- left end position:
- 1508114
- transcription direction:
- NEGATIVE
- right end position:
- 1530127
- centisome position:
- 18.091465
- Synonym(s):
- Esi_0087_0017
- Esi0087_0017
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome