Difference between revisions of "RXN-12002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12002 RXN-12002] == * direction: ** LEFT-TO-RIGHT * common name: ** Adenylate kinase/UMP-CMP ki...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12002 RXN-12002] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Adenylate kinase/UMP-CMP kinase |
− | * | + | ** Aspartate/glutamate/uridylate kinase |
− | ** | + | ** aspartate/glutamate/uridylate kinase |
+ | ** cytidylate kinase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.7.4.22 EC-2.7.4.22] | ||
+ | ** [http://enzyme.expasy.org/EC/2.7.4.14 EC-2.7.4.14] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[UMP]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 UMP[c] '''=>''' 1 UDP[c] '''+''' 1 ADP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_003080]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-27_003730]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-16_005090]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-07_003680]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-24_000610]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-14_004920]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-7176]], UTP and CTP de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7176 PWY-7176] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24400 24400] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00158 R00158] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Adenylate kinase/UMP-CMP kinase}} | |
− | + | {{#set: common name=Aspartate/glutamate/uridylate kinase}} | |
− | + | {{#set: common name=aspartate/glutamate/uridylate kinase}} | |
− | {{#set: | + | {{#set: common name=cytidylate kinase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.4.22}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.4.14}} |
− | {{#set: | + | {{#set: gene associated=Ec-06_003080|Ec-27_003730|Ec-16_005090|Ec-07_003680|Ec-24_000610|Ec-14_004920}} |
− | {{#set: | + | {{#set: in pathway=PWY-7176}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:40, 21 March 2018
Contents
Reaction RXN-12002
- direction:
- LEFT-TO-RIGHT
- common name:
- Adenylate kinase/UMP-CMP kinase
- Aspartate/glutamate/uridylate kinase
- aspartate/glutamate/uridylate kinase
- cytidylate kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 UMP[c] => 1 UDP[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_003080
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_003730
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_005090
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_003680
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_000610
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_004920
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7176, UTP and CTP de novo biosynthesis: PWY-7176
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links