Difference between revisions of "CPD-6993"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_000290 == * Synonym(s): ** Esi_0054_0136 ** Esi0054_0136 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == |
+ | * smiles: | ||
+ | ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) | ||
+ | * inchi key: | ||
+ | ** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N | ||
+ | * common name: | ||
+ | ** pinocembrin chalcone | ||
+ | * molecular weight: | ||
+ | ** 256.257 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-7647]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-7645]] |
− | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] | ||
+ | {{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} | ||
+ | {{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} | ||
+ | {{#set: common name=pinocembrin chalcone}} | ||
+ | {{#set: molecular weight=256.257 }} | ||
+ | {{#set: consumed by=RXN-7647}} | ||
+ | {{#set: produced by=RXN-7645}} |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-6993
- smiles:
- C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
- inchi key:
- InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
- common name:
- pinocembrin chalcone
- molecular weight:
- 256.257
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links