Difference between revisions of "CPD1F-126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C |
− | + | ||
− | + | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N |
+ | * common name: | ||
+ | ** γ-carotene | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 536.882 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β,ψ-carotene |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-151]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1F-150]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR01070260 |
− | + | ||
− | + | ||
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280791 5280791] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444349.html 4444349] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27740 27740] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05435 C05435] |
− | {{#set: smiles= | + | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N}} |
− | {{#set: | + | {{#set: common name=γ-carotene}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=536.882 }} |
− | {{#set: common name= | + | {{#set: common name=β,ψ-carotene}} |
− | {{#set: | + | {{#set: consumed by=RXN1F-151}} |
+ | {{#set: produced by=RXN1F-150}} |
Latest revision as of 20:41, 21 March 2018
Contents
Metabolite CPD1F-126
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C
- inchi key:
- InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N
- common name:
- γ-carotene
- molecular weight:
- 536.882
- Synonym(s):
- β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links