Difference between revisions of "TMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18351 CPD-18351] == * smiles: ** CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L |
* common name: | * common name: | ||
| − | ** | + | ** dTMP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 320.195 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** T |
| − | ** | + | ** thymidylic acid |
| + | ** thymidine monophosphate | ||
| + | ** deoxythymidylate | ||
| + | ** TMP | ||
| + | ** thymidine 5'-monophosphate | ||
| + | ** thymidine-phosphate | ||
| + | ** thymidine 5'-phosphate | ||
| + | ** Deoxythymidine 5'-phosphate | ||
| + | ** 5'-Thymidylic acid | ||
| + | ** Deoxythymidylic acid | ||
| + | ** Thymidylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DTMPKI-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THYMIDYLATESYN-RXN]] |
| − | * [[RXN- | + | * [[RXN-14200]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14213]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CAS : 365-07-1 |
| − | {{#set: inchi key=InChIKey= | + | * BIGG : 34753 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755631 16755631] |
| − | {{#set: common name= | + | * HMDB : HMDB01227 |
| − | {{#set: produced by= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00364 C00364] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10239189.html 10239189] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63528 63528] | ||
| + | * METABOLIGHTS : MTBLC63528 | ||
| + | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))}} | ||
| + | {{#set: inchi key=InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L}} | ||
| + | {{#set: common name=dTMP}} | ||
| + | {{#set: molecular weight=320.195 }} | ||
| + | {{#set: common name=T|thymidylic acid|thymidine monophosphate|deoxythymidylate|TMP|thymidine 5'-monophosphate|thymidine-phosphate|thymidine 5'-phosphate|Deoxythymidine 5'-phosphate|5'-Thymidylic acid|Deoxythymidylic acid|Thymidylate}} | ||
| + | {{#set: consumed by=DTMPKI-RXN}} | ||
| + | {{#set: produced by=THYMIDYLATESYN-RXN|RXN-14200}} | ||
| + | {{#set: reversible reaction associated=RXN-14213}} | ||
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite TMP
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))
- inchi key:
- InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L
- common name:
- dTMP
- molecular weight:
- 320.195
- Synonym(s):
- T
- thymidylic acid
- thymidine monophosphate
- deoxythymidylate
- TMP
- thymidine 5'-monophosphate
- thymidine-phosphate
- thymidine 5'-phosphate
- Deoxythymidine 5'-phosphate
- 5'-Thymidylic acid
- Deoxythymidylic acid
- Thymidylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 365-07-1
- BIGG : 34753
- PUBCHEM:
- HMDB : HMDB01227
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC63528
"CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))" cannot be used as a page name in this wiki.
