Difference between revisions of "RXN-1602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.1.34 EC-3.1.1.34] |
| − | + | ** [http://enzyme.expasy.org/EC/3.1.1.79 EC-3.1.1.79] | |
| − | + | ||
| − | * | + | |
| − | * | + | |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[WATER]][c] '''+''' 1 [[1-2-Diglycerides]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Fatty-Acids]][c] '''+''' 1 [[CPD-409]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 H2O[c] '''+''' 1 a 1,2-diglyceride[c] '''=>''' 1 H+[c] '''+''' 1 a fatty acid[c] '''+''' 1 a 2-monoglyceride[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[LIPAS-PWY]], triacylglycerol degradation: [http://metacyc.org/META/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY] | ||
| + | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18761 18761] | |
| − | ** [http:// | + | * LIGAND-RXN: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05209 R05209] | |
| − | * LIGAND- | + | * UNIPROT: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P11153 P11153] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P11152 P11152] |
| − | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q06000 Q06000] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P06858 P06858] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11602 P11602] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49923 P49923] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q29524 Q29524] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-3.1.1.34}} |
| − | {{#set: | + | {{#set: ec number=EC-3.1.1.79}} |
| − | {{#set: | + | {{#set: in pathway=LIPAS-PWY}} |
| + | {{#set: reconstruction category=annotation}} | ||
| + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 19:41, 21 March 2018
Contents
Reaction RXN-1602
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 1-2-Diglycerides[c] => 1 PROTON[c] + 1 Fatty-Acids[c] + 1 CPD-409[c]
- With common name(s):
- 1 H2O[c] + 1 a 1,2-diglyceride[c] => 1 H+[c] + 1 a fatty acid[c] + 1 a 2-monoglyceride[c]
Genes associated with this reaction
Pathways
- LIPAS-PWY, triacylglycerol degradation: LIPAS-PWY
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
