Difference between revisions of "ILE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AGPKZVBTJJNPAG-WHFBIAK...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC(C)C([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-isoleucine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 131.174 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** I |
| − | ** | + | ** ile |
| − | ** | + | ** iso-leucine |
| − | ** | + | ** L-ile |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 73-32-5 | ||
| + | * BIGG : 34887 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7043901 7043901] |
| − | * | + | * HMDB : HMDB00172 |
| − | ** [http://www. | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00407 C00407] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58045 58045] |
| − | * | + | * METABOLIGHTS : MTBLC58045 |
| − | + | {{#set: smiles=CCC(C)C([N+])C(=O)[O-]}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-isoleucine}} |
| − | {{#set: common name= | + | {{#set: molecular weight=131.174 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=I|ile|iso-leucine|L-ile}} |
| − | {{#set: common name= | + | {{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} |
| − | {{#set: | + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite ILE
- smiles:
- CCC(C)C([N+])C(=O)[O-]
- inchi key:
- InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N
- common name:
- L-isoleucine
- molecular weight:
- 131.174
- Synonym(s):
- I
- ile
- iso-leucine
- L-ile
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-32-5
- BIGG : 34887
- PUBCHEM:
- HMDB : HMDB00172
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58045
"CCC(C)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
