Difference between revisions of "Ec-13 004490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...")
(Created page with "Category:Gene == Gene Ec-13_004490 == * Synonym(s): ** Esi_0106_0041 ** Esi0106_0041 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
+
== Gene Ec-13_004490 ==
* smiles:
+
** CC(=O)C1(C=CC=CC=1)
+
* inchi key:
+
** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
+
* common name:
+
** acetophenone
+
* molecular weight:
+
** 120.151   
+
 
* Synonym(s):
 
* Synonym(s):
** phenylmethylketone
+
** Esi_0106_0041
** methylphenylketone
+
** Esi0106_0041
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
* [[RXN-1302]]
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* CAS : 98-86-2
+
{{#set: common name=Esi_0106_0041|Esi0106_0041}}
* DRUGBANK : DB04619
+
{{#set: reaction associated=RXN-8443}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-5381}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410]
+
* HMDB : HMDB33910
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7132.html 7132]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632]
+
{{#set: smiles=CC(=O)C1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}}
+
{{#set: common name=acetophenone}}
+
{{#set: molecular weight=120.151    }}
+
{{#set: common name=phenylmethylketone|methylphenylketone}}
+
{{#set: reversible reaction associated=RXN-1302}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-13_004490

  • Synonym(s):
    • Esi_0106_0041
    • Esi0106_0041

Reactions associated

Pathways associated

External links