Difference between revisions of "Ec-19 004330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Ec-19_004330 == * left end position: ** 4727043 * transcription direction: ** POSITIVE * right end position: ** 4730077 * centisome position: ** 79.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] ==
+
== Gene Ec-19_004330 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4727043
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-trans, 4-trans-undecadienoyl-CoA
+
** 4730077
−
* molecular weight:
+
* centisome position:
−
** 927.749    
+
** 79.17082    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 4E-undecadienoyl-CoA
+
** Esi_0051_0010
 +
** Esi0051_0010
 +
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14790]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14789]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4727043}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658303 90658303]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=4730077}}
−
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J}}
+
{{#set: centisome position=79.17082   }}
−
{{#set: common name=2-trans, 4-trans-undecadienoyl-CoA}}
+
{{#set: common name=Esi_0051_0010|Esi0051_0010|PK}}
−
{{#set: molecular weight=927.749   }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=2E, 4E-undecadienoyl-CoA}}
+
−
{{#set: consumed by=RXN-14790}}
+
−
{{#set: produced by=RXN-14789}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-19_004330

  • left end position:
    • 4727043
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4730077
  • centisome position:
    • 79.17082
  • Synonym(s):
    • Esi_0051_0010
    • Esi0051_0010
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_004330&oldid=28736"